C13H24Br2O3Si — CID 144689661
methyl (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoate (PubChem CID 144689661) has the molecular formula C13H24Br2O3Si and a molecular weight of 416.23 g/mol. Its IUPAC name is methyl (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoate.
| Compound Name | methyl (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoate |
|---|---|
| PubChem CID | 144689661 |
| Molecular Formula | C13H24Br2O3Si |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | methyl (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoate |
| SMILES | COC(=O)CC[C@@H](C=C(Br)Br)O[Si](C)(C)CC(C)C |
| InChI | InChI=1S/C13H24Br2O3Si/c1-10(2)9-19(4,5)18-11(8-12(14)15)6-7-13(16)17-3/h8,10-11H,6-7,9H2,1-5H3/t11-/m0/s1 |
| InChIKey | GSFORQSPSNBEDR-NSHDSACASA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|