C19H38O3Si — CID 71489918
[(2R,3R)-2,5-dimethyl-3-tri(propan-2-yl)silyloxyhex-5-enyl] acetate (PubChem CID 71489918) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is [(2R,3R)-2,5-dimethyl-3-tri(propan-2-yl)silyloxyhex-5-enyl] acetate.
| Compound Name | [(2R,3R)-2,5-dimethyl-3-tri(propan-2-yl)silyloxyhex-5-enyl] acetate |
|---|---|
| PubChem CID | 71489918 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | [(2R,3R)-2,5-dimethyl-3-tri(propan-2-yl)silyloxyhex-5-enyl] acetate |
| SMILES | C=C(C)C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)COC(C)=O |
| InChI | InChI=1S/C19H38O3Si/c1-13(2)11-19(17(9)12-21-18(10)20)22-23(14(3)4,15(5)6)16(7)8/h14-17,19H,1,11-12H2,2-10H3/t17-,19-/m1/s1 |
| InChIKey | LQKCWADDJIDDFI-IEBWSBKVSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|