C30H62O3SiSn — CID 15442530
[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(tributylstannylmethyl)hex-5-enyl] 2,2-dimethylpropanoate (PubChem CID 15442530) has the molecular formula C30H62O3SiSn and a molecular weight of 617.62 g/mol. Its IUPAC name is [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(tributylstannylmethyl)hex-5-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(tributylstannylmethyl)hex-5-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15442530 |
| Molecular Formula | C30H62O3SiSn |
| Molecular Weight | 617.62 g/mol |
| Exact Mass | 618.35 |
| IUPAC Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(tributylstannylmethyl)hex-5-enyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C[C@@H](CCOC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C18H35O3Si.3C4H9.Sn/c1-14(2)13-15(21-22(9,10)18(6,7)8)11-12-20-16(19)17(3,4)5;3*1-3-4-2;/h15H,1-2,11-13H2,3-10H3;3*1,3-4H2,2H3;/t15-;;;;/m1..../s1 |
| InChIKey | UAAVPQCQCKULAU-FKOXPEIHSA-N |
| XLogP | 10.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.62 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|