C19H40O2Si2 — CID 102220130
2-[bis(trimethylsilyl)methyl]hept-1-en-4-yl 2,2-dimethylpropanoate (PubChem CID 102220130) has the molecular formula C19H40O2Si2 and a molecular weight of 356.70 g/mol. Its IUPAC name is 2-[bis(trimethylsilyl)methyl]hept-1-en-4-yl 2,2-dimethylpropanoate.
| Compound Name | 2-[bis(trimethylsilyl)methyl]hept-1-en-4-yl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102220130 |
| Molecular Formula | C19H40O2Si2 |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 2-[bis(trimethylsilyl)methyl]hept-1-en-4-yl 2,2-dimethylpropanoate |
| SMILES | C=C(CC(CCC)OC(=O)C(C)(C)C)C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C19H40O2Si2/c1-12-13-16(21-18(20)19(3,4)5)14-15(2)17(22(6,7)8)23(9,10)11/h16-17H,2,12-14H2,1,3-11H3 |
| InChIKey | IHXBBAVUWWVTEB-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|