C18H36O2Si — CID 12841784
2-(trimethylsilylmethyl)dodec-1-en-5-yl acetate (PubChem CID 12841784) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is 2-(trimethylsilylmethyl)dodec-1-en-5-yl acetate.
| Compound Name | 2-(trimethylsilylmethyl)dodec-1-en-5-yl acetate |
|---|---|
| PubChem CID | 12841784 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 2-(trimethylsilylmethyl)dodec-1-en-5-yl acetate |
| SMILES | C=C(CCC(CCCCCCC)OC(C)=O)C[Si](C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-7-8-9-10-11-12-18(20-17(3)19)14-13-16(2)15-21(4,5)6/h18H,2,7-15H2,1,3-6H3 |
| InChIKey | FOSFIQZUEQAFQR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|