About [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate
[(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate (PubChem CID 162517816) has the molecular formula C26H52O3Si
and a molecular weight of 440.79 g/mol. Its IUPAC name is [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate.
Molecular Properties
| Compound Name | [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate |
| PubChem CID | 162517816 |
| Molecular Formula | C26H52O3Si |
| Molecular Weight | 440.79 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCCO[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C26H52O3Si/c1-8-9-10-18-21-25(29-24(2)27)22-19-16-14-12-11-13-15-17-20-23-28-30(6,7)26(3,4)5/h16,19,25H,8-15,17-18,20-23H2,1-7H3/b19-16-/t25-/m1/s1 |
| InChIKey | MIQUZJKKFOQJMS-FVLIZWQSSA-N |
| XLogP | 8.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.79 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate?
The IUPAC name of [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate (CID 162517816) is [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate.
What is the SMILES notation for [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate?
The canonical SMILES for [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate is CCCCCC[C@H](C/C=C\CCCCCCCCO[Si](C)(C)C(C)(C)C)OC(C)=O.
What is the InChIKey of [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate?
The InChIKey is MIQUZJKKFOQJMS-FVLIZWQSSA-N. The full InChI is InChI=1S/C26H52O3Si/c1-8-9-10-18-21-25(29-24(2)27)22-19-16-14-12-11-13-15-17-20-23-28-30(6,7)26(3,4)5/h16,19,25H,8-15,17-18,20-23H2,1-7H3/b19-16-/t25-/m1/s1.
What are the key properties of [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate?
[(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate has a molecular weight of 440.79 g/mol, XLogP of 8.59, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,7R)-18-[tert-butyl(dimethyl)silyl]oxyoctadec-9-en-7-yl] acetate is sourced from PubChem (CID 162517816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).