C24H46O3Si — CID 11825755
ethyl (6S)-6-tri(propan-2-yl)silyloxytrideca-3,4-dienoate (PubChem CID 11825755) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is ethyl (6S)-6-tri(propan-2-yl)silyloxytrideca-3,4-dienoate.
| Compound Name | ethyl (6S)-6-tri(propan-2-yl)silyloxytrideca-3,4-dienoate |
|---|---|
| PubChem CID | 11825755 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | ethyl (6S)-6-tri(propan-2-yl)silyloxytrideca-3,4-dienoate |
| SMILES | CCCCCCC[C@@H](C=C=CCC(=O)OCC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H46O3Si/c1-9-11-12-13-14-17-23(18-15-16-19-24(25)26-10-2)27-28(20(3)4,21(5)6)22(7)8/h16,18,20-23H,9-14,17,19H2,1-8H3/t15?,23-/m0/s1 |
| InChIKey | OPDBSCOPYVVFAM-GMTBNIFVSA-N |
| XLogP | 7.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|