C26H50O3Si — CID 11826286
[(6R,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadec-14-en-6-yl] pent-4-enoate (PubChem CID 11826286) has the molecular formula C26H50O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is [(6R,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadec-14-en-6-yl] pent-4-enoate.
| Compound Name | [(6R,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadec-14-en-6-yl] pent-4-enoate |
|---|---|
| PubChem CID | 11826286 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | [(6R,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadec-14-en-6-yl] pent-4-enoate |
| SMILES | C=CCCC(=O)O[C@H](CCCCC)CCCCC[C@H](CC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O3Si/c1-9-12-15-19-23(28-25(27)22-13-10-2)20-16-14-17-21-24(18-11-3)29-30(7,8)26(4,5)6/h10-11,23-24H,2-3,9,12-22H2,1,4-8H3/t23-,24+/m1/s1 |
| InChIKey | ZAZQMMJJQQWQSY-RPWUZVMVSA-N |
| XLogP | 8.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|