C42H86O5Si3 — CID 56594146
[(3R,4S,6R)-3,4-bis[tri(propan-2-yl)silyloxy]tridec-1-en-6-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate (PubChem CID 56594146) has the molecular formula C42H86O5Si3 and a molecular weight of 755.40 g/mol. Its IUPAC name is [(3R,4S,6R)-3,4-bis[tri(propan-2-yl)silyloxy]tridec-1-en-6-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate.
| Compound Name | [(3R,4S,6R)-3,4-bis[tri(propan-2-yl)silyloxy]tridec-1-en-6-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
|---|---|
| PubChem CID | 56594146 |
| Molecular Formula | C42H86O5Si3 |
| Molecular Weight | 755.40 g/mol |
| Exact Mass | 754.58 |
| IUPAC Name | [(3R,4S,6R)-3,4-bis[tri(propan-2-yl)silyloxy]tridec-1-en-6-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-enoate |
| SMILES | C=C[C@H](CC(=O)O[C@H](CCCCCCC)C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C=C)O[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C42H86O5Si3/c1-21-24-25-26-27-28-38(44-41(43)30-37(22-2)45-48(19,20)42(16,17)18)29-40(47-50(34(10)11,35(12)13)36(14)15)39(23-3)46-49(31(4)5,32(6)7)33(8)9/h22-23,31-40H,2-3,21,24-30H2,1,4-20H3/t37-,38-,39-,40+/m1/s1 |
| InChIKey | SOQTYCUQYHWWFN-FJQXUWRQSA-N |
| XLogP | 13.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.40 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|