C38H78O5Si3 — CID 44604461
[(3R,5S,7R,9R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]hexadec-1-en-3-yl] but-3-enoate (PubChem CID 44604461) has the molecular formula C38H78O5Si3 and a molecular weight of 699.29 g/mol. Its IUPAC name is [(3R,5S,7R,9R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]hexadec-1-en-3-yl] but-3-enoate.
| Compound Name | [(3R,5S,7R,9R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]hexadec-1-en-3-yl] but-3-enoate |
|---|---|
| PubChem CID | 44604461 |
| Molecular Formula | C38H78O5Si3 |
| Molecular Weight | 699.29 g/mol |
| Exact Mass | 698.52 |
| IUPAC Name | [(3R,5S,7R,9R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]hexadec-1-en-3-yl] but-3-enoate |
| SMILES | C=CCC(=O)O[C@@H](C=C)C[C@@H](C[C@@H](C[C@@H](CCCCCCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H78O5Si3/c1-19-22-23-24-25-27-32(41-44(13,14)36(4,5)6)29-34(43-46(17,18)38(10,11)12)30-33(42-45(15,16)37(7,8)9)28-31(21-3)40-35(39)26-20-2/h20-21,31-34H,2-3,19,22-30H2,1,4-18H3/t31-,32+,33-,34+/m0/s1 |
| InChIKey | CHSUXOKLPQYACT-GJZXTFMBSA-N |
| XLogP | 12.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.29 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|