C32H66O5Si3 — CID 11342536
[(4R,5R,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]oct-7-en-4-yl] (2R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate (PubChem CID 11342536) has the molecular formula C32H66O5Si3 and a molecular weight of 615.13 g/mol. Its IUPAC name is [(4R,5R,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]oct-7-en-4-yl] (2R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate.
| Compound Name | [(4R,5R,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]oct-7-en-4-yl] (2R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
|---|---|
| PubChem CID | 11342536 |
| Molecular Formula | C32H66O5Si3 |
| Molecular Weight | 615.13 g/mol |
| Exact Mass | 614.42 |
| IUPAC Name | [(4R,5R,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]oct-7-en-4-yl] (2R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
| SMILES | C=CCC[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)O[C@H](CCC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H66O5Si3/c1-19-22-24-27(36-39(15,16)31(7,8)9)29(33)34-26(23-20-2)28(37-40(17,18)32(10,11)12)25(21-3)35-38(13,14)30(4,5)6/h19,21,25-28H,1,3,20,22-24H2,2,4-18H3/t25-,26+,27+,28-/m0/s1 |
| InChIKey | GRJVQOMPYHSSJQ-HFLBTKGNSA-N |
| XLogP | 10.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.13 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|