C16H32O3Si — CID 11001086
8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl acetate (PubChem CID 11001086) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is 8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl acetate.
| Compound Name | 8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl acetate |
|---|---|
| PubChem CID | 11001086 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl acetate |
| SMILES | C=CC(CCCCCO[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C16H32O3Si/c1-8-15(19-14(2)17)12-10-9-11-13-18-20(6,7)16(3,4)5/h8,15H,1,9-13H2,2-7H3 |
| InChIKey | COAARSSADOEWEK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|