C14H27IO3Si — CID 14378824
[(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] acetate (PubChem CID 14378824) has the molecular formula C14H27IO3Si and a molecular weight of 398.36 g/mol. Its IUPAC name is [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] acetate.
| Compound Name | [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 14378824 |
| Molecular Formula | C14H27IO3Si |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | [(E)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpent-4-en-2-yl] acetate |
| SMILES | CC(=O)OC(CO[Si](C)(C)C(C)(C)C)C/C(C)=C/I |
| InChI | InChI=1S/C14H27IO3Si/c1-11(9-15)8-13(18-12(2)16)10-17-19(6,7)14(3,4)5/h9,13H,8,10H2,1-7H3/b11-9+ |
| InChIKey | HWBFCYDYLDNXEC-PKNBQFBNSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|