C15H27IO3Si — CID 11546028
[(1Z)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-iodo-2-methylpenta-1,4-dien-3-yl] acetate (PubChem CID 11546028) has the molecular formula C15H27IO3Si and a molecular weight of 410.37 g/mol. Its IUPAC name is [(1Z)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-iodo-2-methylpenta-1,4-dien-3-yl] acetate.
| Compound Name | [(1Z)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-iodo-2-methylpenta-1,4-dien-3-yl] acetate |
|---|---|
| PubChem CID | 11546028 |
| Molecular Formula | C15H27IO3Si |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | [(1Z)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-iodo-2-methylpenta-1,4-dien-3-yl] acetate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C(OC(C)=O)/C(C)=C\I |
| InChI | InChI=1S/C15H27IO3Si/c1-11(9-16)14(19-13(3)17)12(2)10-18-20(7,8)15(4,5)6/h9,14H,2,10H2,1,3-8H3/b11-9- |
| InChIKey | SYQMSILRFBGUEE-LUAWRHEFSA-N |
| XLogP | 4.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|