C15H29IO2Si — CID 138977409
[(Z,3R)-1-iodo-1-triethylsilylhept-1-en-3-yl] acetate (PubChem CID 138977409) has the molecular formula C15H29IO2Si and a molecular weight of 396.39 g/mol. Its IUPAC name is [(Z,3R)-1-iodo-1-triethylsilylhept-1-en-3-yl] acetate.
| Compound Name | [(Z,3R)-1-iodo-1-triethylsilylhept-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 138977409 |
| Molecular Formula | C15H29IO2Si |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [(Z,3R)-1-iodo-1-triethylsilylhept-1-en-3-yl] acetate |
| SMILES | CCCC[C@H](/C=C(\I)[Si](CC)(CC)CC)OC(C)=O |
| InChI | InChI=1S/C15H29IO2Si/c1-6-10-11-14(18-13(5)17)12-15(16)19(7-2,8-3)9-4/h12,14H,6-11H2,1-5H3/b15-12+/t14-/m1/s1 |
| InChIKey | FPUAJQMHIDYNDP-FQZGENGWSA-N |
| XLogP | 5.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|