C14H22O2Si — CID 141310988
9-trimethylsilylnona-1,2-dien-8-yn-4-yl acetate (PubChem CID 141310988) has the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. Its IUPAC name is 9-trimethylsilylnona-1,2-dien-8-yn-4-yl acetate.
| Compound Name | 9-trimethylsilylnona-1,2-dien-8-yn-4-yl acetate |
|---|---|
| PubChem CID | 141310988 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 9-trimethylsilylnona-1,2-dien-8-yn-4-yl acetate |
| SMILES | C=C=CC(CCCC#C[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C14H22O2Si/c1-6-10-14(16-13(2)15)11-8-7-9-12-17(3,4)5/h10,14H,1,7-8,11H2,2-5H3 |
| InChIKey | NQAXFYBXWGRTNY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|