C14H16O2Si — CID 45112520
(5S)-5-(7-trimethylsilylhepta-1,2-dien-4,6-diynyl)oxolan-2-one (PubChem CID 45112520) has the molecular formula C14H16O2Si and a molecular weight of 244.37 g/mol. Its IUPAC name is (5S)-5-(7-trimethylsilylhepta-1,2-dien-4,6-diynyl)oxolan-2-one.
| Compound Name | (5S)-5-(7-trimethylsilylhepta-1,2-dien-4,6-diynyl)oxolan-2-one |
|---|---|
| PubChem CID | 45112520 |
| Molecular Formula | C14H16O2Si |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (5S)-5-(7-trimethylsilylhepta-1,2-dien-4,6-diynyl)oxolan-2-one |
| SMILES | C[Si](C)(C)C#CC#CC=C=C[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C14H16O2Si/c1-17(2,3)12-8-6-4-5-7-9-13-10-11-14(15)16-13/h5,9,13H,10-11H2,1-3H3/t7?,13-/m1/s1 |
| InChIKey | FUKGBELQLNLELR-URRWNQLISA-N |
| XLogP | 2.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|