C15H24O4Si — CID 139649642
[(4R,6R)-6-acetyloxy-1-trimethylsilyloct-7-en-1-yn-4-yl] acetate (PubChem CID 139649642) has the molecular formula C15H24O4Si and a molecular weight of 296.44 g/mol. Its IUPAC name is [(4R,6R)-6-acetyloxy-1-trimethylsilyloct-7-en-1-yn-4-yl] acetate.
| Compound Name | [(4R,6R)-6-acetyloxy-1-trimethylsilyloct-7-en-1-yn-4-yl] acetate |
|---|---|
| PubChem CID | 139649642 |
| Molecular Formula | C15H24O4Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(4R,6R)-6-acetyloxy-1-trimethylsilyloct-7-en-1-yn-4-yl] acetate |
| SMILES | C=C[C@@H](C[C@@H](CC#C[Si](C)(C)C)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C15H24O4Si/c1-7-14(18-12(2)16)11-15(19-13(3)17)9-8-10-20(4,5)6/h7,14-15H,1,9,11H2,2-6H3/t14-,15+/m0/s1 |
| InChIKey | KJXXWPZYSORHCO-LSDHHAIUSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|