C16H26O4Si — CID 135074338
[(1R)-1-[(2S,3S)-3-(1-triethylsilyloxyprop-2-ynyl)oxiran-2-yl]prop-2-enyl] acetate (PubChem CID 135074338) has the molecular formula C16H26O4Si and a molecular weight of 310.47 g/mol. Its IUPAC name is [(1R)-1-[(2S,3S)-3-(1-triethylsilyloxyprop-2-ynyl)oxiran-2-yl]prop-2-enyl] acetate.
| Compound Name | [(1R)-1-[(2S,3S)-3-(1-triethylsilyloxyprop-2-ynyl)oxiran-2-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 135074338 |
| Molecular Formula | C16H26O4Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [(1R)-1-[(2S,3S)-3-(1-triethylsilyloxyprop-2-ynyl)oxiran-2-yl]prop-2-enyl] acetate |
| SMILES | C#CC(O[Si](CC)(CC)CC)[C@H]1O[C@H]1[C@@H](C=C)OC(C)=O |
| InChI | InChI=1S/C16H26O4Si/c1-7-13(18-12(6)17)15-16(19-15)14(8-2)20-21(9-3,10-4)11-5/h2,7,13-16H,1,9-11H2,3-6H3/t13-,14?,15+,16-/m1/s1 |
| InChIKey | SGYSPNJJSLTDCN-HEWHGDCOSA-N |
| XLogP | 2.90 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|