C28H42O5Si — CID 135074596
[(Z,1R)-1-[(2S,3S)-3-(9-methyl-1-triethylsilyloxydec-8-en-2,4-diynyl)oxiran-2-yl]-4-prop-2-enoxybut-2-enyl] acetate (PubChem CID 135074596) has the molecular formula C28H42O5Si and a molecular weight of 486.73 g/mol. Its IUPAC name is [(Z,1R)-1-[(2S,3S)-3-(9-methyl-1-triethylsilyloxydec-8-en-2,4-diynyl)oxiran-2-yl]-4-prop-2-enoxybut-2-enyl] acetate.
| Compound Name | [(Z,1R)-1-[(2S,3S)-3-(9-methyl-1-triethylsilyloxydec-8-en-2,4-diynyl)oxiran-2-yl]-4-prop-2-enoxybut-2-enyl] acetate |
|---|---|
| PubChem CID | 135074596 |
| Molecular Formula | C28H42O5Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [(Z,1R)-1-[(2S,3S)-3-(9-methyl-1-triethylsilyloxydec-8-en-2,4-diynyl)oxiran-2-yl]-4-prop-2-enoxybut-2-enyl] acetate |
| SMILES | C=CCOC/C=C\[C@@H](OC(C)=O)[C@@H]1O[C@@H]1C(C#CC#CCCC=C(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H42O5Si/c1-8-21-30-22-17-20-25(31-24(7)29)27-28(32-27)26(33-34(9-2,10-3)11-4)19-16-14-12-13-15-18-23(5)6/h8,17-18,20,25-28H,1,9-11,13,15,21-22H2,2-7H3/b20-17-/t25-,26?,27+,28-/m1/s1 |
| InChIKey | GMJZTJQLOJPZOP-OYVMADDYSA-N |
| XLogP | 5.59 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|