C19H28O4Si — CID 25210045
[(1S,2R,5R,6S)-4-(3-methylbut-3-en-1-ynyl)-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate (PubChem CID 25210045) has the molecular formula C19H28O4Si and a molecular weight of 348.52 g/mol. Its IUPAC name is [(1S,2R,5R,6S)-4-(3-methylbut-3-en-1-ynyl)-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate.
| Compound Name | [(1S,2R,5R,6S)-4-(3-methylbut-3-en-1-ynyl)-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 25210045 |
| Molecular Formula | C19H28O4Si |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [(1S,2R,5R,6S)-4-(3-methylbut-3-en-1-ynyl)-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
| SMILES | C=C(C)C#CC1=C[C@@H](OC(C)=O)[C@@H]2O[C@@H]2[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H28O4Si/c1-7-24(8-2,9-3)23-17-15(11-10-13(4)5)12-16(21-14(6)20)18-19(17)22-18/h12,16-19H,4,7-9H2,1-3,5-6H3/t16-,17-,18+,19-/m1/s1 |
| InChIKey | PCDGNEVFXNCEON-AKHDSKFASA-N |
| XLogP | 3.60 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|