C24H36O4Si — CID 135067651
[(1S,2R,5S,6S)-4-(7-methyl-3-methylideneoct-6-en-1-ynyl)-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate (PubChem CID 135067651) has the molecular formula C24H36O4Si and a molecular weight of 416.63 g/mol. Its IUPAC name is [(1S,2R,5S,6S)-4-(7-methyl-3-methylideneoct-6-en-1-ynyl)-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate.
| Compound Name | [(1S,2R,5S,6S)-4-(7-methyl-3-methylideneoct-6-en-1-ynyl)-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 135067651 |
| Molecular Formula | C24H36O4Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [(1S,2R,5S,6S)-4-(7-methyl-3-methylideneoct-6-en-1-ynyl)-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
| SMILES | C=C(C#CC1=C[C@@H](OC(C)=O)[C@@H]2O[C@@H]2[C@H]1O[Si](CC)(CC)CC)CCC=C(C)C |
| InChI | InChI=1S/C24H36O4Si/c1-8-29(9-2,10-3)28-22-20(15-14-18(6)13-11-12-17(4)5)16-21(26-19(7)25)23-24(22)27-23/h12,16,21-24H,6,8-11,13H2,1-5,7H3/t21-,22+,23+,24-/m1/s1 |
| InChIKey | PQNRYGDFPRCXTK-NAVOZUGXSA-N |
| XLogP | 5.32 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|