C22H28O5Si — CID 134844653
[(E)-3-[(2S,3R)-3-[(2R,3S)-3-[7-[tert-butyl(dimethyl)silyl]oxyhepta-1,3,5-triynyl]oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate (PubChem CID 134844653) has the molecular formula C22H28O5Si and a molecular weight of 400.55 g/mol. Its IUPAC name is [(E)-3-[(2S,3R)-3-[(2R,3S)-3-[7-[tert-butyl(dimethyl)silyl]oxyhepta-1,3,5-triynyl]oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate.
| Compound Name | [(E)-3-[(2S,3R)-3-[(2R,3S)-3-[7-[tert-butyl(dimethyl)silyl]oxyhepta-1,3,5-triynyl]oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 134844653 |
| Molecular Formula | C22H28O5Si |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [(E)-3-[(2S,3R)-3-[(2R,3S)-3-[7-[tert-butyl(dimethyl)silyl]oxyhepta-1,3,5-triynyl]oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/[C@@H]1O[C@H]1[C@@H]1O[C@H]1C#CC#CC#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H28O5Si/c1-17(23)24-15-12-14-19-21(27-19)20-18(26-20)13-10-8-7-9-11-16-25-28(5,6)22(2,3)4/h12,14,18-21H,15-16H2,1-6H3/b14-12+/t18-,19-,20+,21+/m0/s1 |
| InChIKey | XFFVNXATZWFBNQ-FPKCDSDLSA-N |
| XLogP | 2.67 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|