C11H12O4 — CID 134844410
[(E)-3-[(2S,3R)-3-[(2R,3S)-3-ethynyloxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate (PubChem CID 134844410) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is [(E)-3-[(2S,3R)-3-[(2R,3S)-3-ethynyloxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate.
| Compound Name | [(E)-3-[(2S,3R)-3-[(2R,3S)-3-ethynyloxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 134844410 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | [(E)-3-[(2S,3R)-3-[(2R,3S)-3-ethynyloxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate |
| SMILES | C#C[C@@H]1O[C@H]1[C@@H]1O[C@H]1/C=C/COC(C)=O |
| InChI | InChI=1S/C11H12O4/c1-3-8-10(14-8)11-9(15-11)5-4-6-13-7(2)12/h1,4-5,8-11H,6H2,2H3/b5-4+/t8-,9-,10+,11+/m0/s1 |
| InChIKey | DPMCWJYXQWHFRF-HAKIWRNISA-N |
| XLogP | 0.27 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|