C10H12O5 — CID 14351162
[(1R,2S,3S,6R)-2-acetyloxy-7-oxabicyclo[4.1.0]hept-4-en-3-yl] acetate (PubChem CID 14351162) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is [(1R,2S,3S,6R)-2-acetyloxy-7-oxabicyclo[4.1.0]hept-4-en-3-yl] acetate.
| Compound Name | [(1R,2S,3S,6R)-2-acetyloxy-7-oxabicyclo[4.1.0]hept-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 14351162 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | [(1R,2S,3S,6R)-2-acetyloxy-7-oxabicyclo[4.1.0]hept-4-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2O[C@@H]2C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H12O5/c1-5(11)13-7-3-4-8-10(15-8)9(7)14-6(2)12/h3-4,7-10H,1-2H3/t7-,8+,9-,10+/m0/s1 |
| InChIKey | ASODISXRVQWJOR-QCLAVDOMSA-N |
| XLogP | 0.19 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|