C16H14O5 — CID 71613833
[(E)-3-[(2R,3S)-3-[(2S,3R)-3-(7-hydroxyhepta-1,3,5-triynyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate (PubChem CID 71613833) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is [(E)-3-[(2R,3S)-3-[(2S,3R)-3-(7-hydroxyhepta-1,3,5-triynyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate.
| Compound Name | [(E)-3-[(2R,3S)-3-[(2S,3R)-3-(7-hydroxyhepta-1,3,5-triynyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 71613833 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [(E)-3-[(2R,3S)-3-[(2S,3R)-3-(7-hydroxyhepta-1,3,5-triynyl)oxiran-2-yl]oxiran-2-yl]prop-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/[C@H]1O[C@@H]1[C@H]1O[C@@H]1C#CC#CC#CCO |
| InChI | InChI=1S/C16H14O5/c1-12(18)19-11-7-9-14-16(21-14)15-13(20-15)8-5-3-2-4-6-10-17/h7,9,13-17H,10-11H2,1H3/b9-7+/t13-,14-,15+,16+/m1/s1 |
| InChIKey | CVFDUGAXSFOYQC-HKDHDNDHSA-N |
| XLogP | -0.36 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|