C17H18O5 — CID 11779670
[(E)-5-[3-(7-hydroxyhepta-1,3,5-triynyl)oxiran-2-yl]-5-methoxypent-2-enyl] acetate (PubChem CID 11779670) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(E)-5-[3-(7-hydroxyhepta-1,3,5-triynyl)oxiran-2-yl]-5-methoxypent-2-enyl] acetate.
| Compound Name | [(E)-5-[3-(7-hydroxyhepta-1,3,5-triynyl)oxiran-2-yl]-5-methoxypent-2-enyl] acetate |
|---|---|
| PubChem CID | 11779670 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [(E)-5-[3-(7-hydroxyhepta-1,3,5-triynyl)oxiran-2-yl]-5-methoxypent-2-enyl] acetate |
| SMILES | COC(C/C=C/COC(C)=O)C1OC1C#CC#CC#CCO |
| InChI | InChI=1S/C17H18O5/c1-14(19)21-13-9-7-10-15(20-2)17-16(22-17)11-6-4-3-5-8-12-18/h7,9,15-18H,10,12-13H2,1-2H3/b9-7+ |
| InChIKey | NRGLONKWSDUXLU-VQHVLOKHSA-N |
| XLogP | 0.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|