C17H26O7 — CID 71573610
[(2R,3R,4R,6E,8R)-3,4-diacetyloxy-8-hydroxyundeca-6,10-dien-2-yl] acetate (PubChem CID 71573610) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(2R,3R,4R,6E,8R)-3,4-diacetyloxy-8-hydroxyundeca-6,10-dien-2-yl] acetate.
| Compound Name | [(2R,3R,4R,6E,8R)-3,4-diacetyloxy-8-hydroxyundeca-6,10-dien-2-yl] acetate |
|---|---|
| PubChem CID | 71573610 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(2R,3R,4R,6E,8R)-3,4-diacetyloxy-8-hydroxyundeca-6,10-dien-2-yl] acetate |
| SMILES | C=CC[C@@H](O)/C=C/C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C17H26O7/c1-6-8-15(21)9-7-10-16(23-13(4)19)17(24-14(5)20)11(2)22-12(3)18/h6-7,9,11,15-17,21H,1,8,10H2,2-5H3/b9-7+/t11-,15-,16-,17-/m1/s1 |
| InChIKey | VOKCQJXNYLFTAV-RQFCIRASSA-N |
| XLogP | 1.68 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|