C19H28O10 — CID 15690705
[(2R,3S,4R)-2,3,4,6-tetraacetyloxynon-8-enyl] acetate (PubChem CID 15690705) has the molecular formula C19H28O10 and a molecular weight of 416.42 g/mol. Its IUPAC name is [(2R,3S,4R)-2,3,4,6-tetraacetyloxynon-8-enyl] acetate.
| Compound Name | [(2R,3S,4R)-2,3,4,6-tetraacetyloxynon-8-enyl] acetate |
|---|---|
| PubChem CID | 15690705 |
| Molecular Formula | C19H28O10 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [(2R,3S,4R)-2,3,4,6-tetraacetyloxynon-8-enyl] acetate |
| SMILES | C=CCC(C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C19H28O10/c1-7-8-16(26-12(3)21)9-17(27-13(4)22)19(29-15(6)24)18(28-14(5)23)10-25-11(2)20/h7,16-19H,1,8-10H2,2-6H3/t16?,17-,18-,19+/m1/s1 |
| InChIKey | XVCFNQOAWPXNCS-MSRNWOCLSA-N |
| XLogP | 1.24 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|