C18H36O5Si2 — CID 134836941
[(1S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-4-trimethylsilyloxycyclohex-3-en-1-yl] acetate (PubChem CID 134836941) has the molecular formula C18H36O5Si2 and a molecular weight of 388.65 g/mol. Its IUPAC name is [(1S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-4-trimethylsilyloxycyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-4-trimethylsilyloxycyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 134836941 |
| Molecular Formula | C18H36O5Si2 |
| Molecular Weight | 388.65 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | [(1S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-4-trimethylsilyloxycyclohex-3-en-1-yl] acetate |
| SMILES | CO[C@@H]1C(O[Si](C)(C)C)=CC[C@H](OC(C)=O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O5Si2/c1-13(19)21-14-11-12-15(22-24(6,7)8)16(20-5)17(14)23-25(9,10)18(2,3)4/h12,14,16-17H,11H2,1-10H3/t14-,16+,17+/m0/s1 |
| InChIKey | OWUXMXFDSHJFQS-USXIJHARSA-N |
| XLogP | 4.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|