C18H38O5Si2 — CID 134836950
tert-butyl-[(1R,2S,6S)-2-methoxy-6-(methoxymethoxy)-3-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane (PubChem CID 134836950) has the molecular formula C18H38O5Si2 and a molecular weight of 390.67 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,6S)-2-methoxy-6-(methoxymethoxy)-3-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,6S)-2-methoxy-6-(methoxymethoxy)-3-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134836950 |
| Molecular Formula | C18H38O5Si2 |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | tert-butyl-[(1R,2S,6S)-2-methoxy-6-(methoxymethoxy)-3-trimethylsilyloxycyclohex-3-en-1-yl]oxy-dimethylsilane |
| SMILES | COCO[C@H]1CC=C(O[Si](C)(C)C)[C@@H](OC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O5Si2/c1-18(2,3)25(9,10)23-17-14(21-13-19-4)11-12-15(16(17)20-5)22-24(6,7)8/h12,14,16-17H,11,13H2,1-10H3/t14-,16+,17+/m0/s1 |
| InChIKey | JPIVUASEGGFWKO-USXIJHARSA-N |
| XLogP | 4.52 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|