C22H44O4Si2 — CID 169294482
[(3aR,4S,5S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 169294482) has the molecular formula C22H44O4Si2 and a molecular weight of 428.76 g/mol. Its IUPAC name is [(3aR,4S,5S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,5S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 169294482 |
| Molecular Formula | C22H44O4Si2 |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | [(3aR,4S,5S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C22H44O4Si2/c1-15-14-16(25-27(10,11)20(2,3)4)18(26-28(12,13)21(5,6)7)19-17(15)23-22(8,9)24-19/h14,16-19H,1-13H3/t16-,17+,18+,19+/m0/s1 |
| InChIKey | IRVMCZCQCITGOW-WJFTUGDTSA-N |
| XLogP | 6.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|