C32H68O5Si3 — CID 44515760
[(E,2R)-7-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-4-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 44515760) has the molecular formula C32H68O5Si3 and a molecular weight of 617.15 g/mol. Its IUPAC name is [(E,2R)-7-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-4-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E,2R)-7-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-4-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 44515760 |
| Molecular Formula | C32H68O5Si3 |
| Molecular Weight | 617.15 g/mol |
| Exact Mass | 616.44 |
| IUPAC Name | [(E,2R)-7-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-4-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](C/C=C/CC[C@@H]1OC(C)(C)O[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H68O5Si3/c1-25(36-39(15,16)30(5,6)7)22-20-19-21-23-26-28(35-32(11,12)34-26)27(37-40(17,18)31(8,9)10)24-33-38(13,14)29(2,3)4/h19-20,25-28H,21-24H2,1-18H3/b20-19+/t25-,26+,27-,28+/m1/s1 |
| InChIKey | GSPFICRFBMVEDF-ZHAXLJPCSA-N |
| XLogP | 10.06 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.15 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|