C24H47IO5Si2 — CID 11519996
[(3aR,6R,7S,7aR)-6-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobut-2-enyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-triethylsilane (PubChem CID 11519996) has the molecular formula C24H47IO5Si2 and a molecular weight of 598.71 g/mol. Its IUPAC name is [(3aR,6R,7S,7aR)-6-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobut-2-enyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-triethylsilane.
| Compound Name | [(3aR,6R,7S,7aR)-6-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobut-2-enyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11519996 |
| Molecular Formula | C24H47IO5Si2 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | [(3aR,6R,7S,7aR)-6-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobut-2-enyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2CO[C@@H]1C/C(I)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H47IO5Si2/c1-11-32(12-2,13-3)30-22-19(26-17-20-21(22)29-24(7,8)28-20)16-18(25)14-15-27-31(9,10)23(4,5)6/h14,19-22H,11-13,15-17H2,1-10H3/b18-14-/t19-,20-,21-,22+/m1/s1 |
| InChIKey | CXLSMGSWVUJENY-HHJLVKRJSA-N |
| XLogP | 7.03 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|