C18H33IO5Si — CID 11525927
(Z)-4-[(3aR,6R,7S,7aR)-2,2-dimethyl-7-triethylsilyloxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-iodobut-2-en-1-ol (PubChem CID 11525927) has the molecular formula C18H33IO5Si and a molecular weight of 484.45 g/mol. Its IUPAC name is (Z)-4-[(3aR,6R,7S,7aR)-2,2-dimethyl-7-triethylsilyloxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-iodobut-2-en-1-ol.
| Compound Name | (Z)-4-[(3aR,6R,7S,7aR)-2,2-dimethyl-7-triethylsilyloxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-iodobut-2-en-1-ol |
|---|---|
| PubChem CID | 11525927 |
| Molecular Formula | C18H33IO5Si |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | (Z)-4-[(3aR,6R,7S,7aR)-2,2-dimethyl-7-triethylsilyloxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-iodobut-2-en-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2CO[C@@H]1C/C(I)=C/CO |
| InChI | InChI=1S/C18H33IO5Si/c1-6-25(7-2,8-3)24-17-14(11-13(19)9-10-20)21-12-15-16(17)23-18(4,5)22-15/h9,14-17,20H,6-8,10-12H2,1-5H3/b13-9-/t14-,15-,16-,17+/m1/s1 |
| InChIKey | BBBDFIQENBXFSR-PGRALFHGSA-N |
| XLogP | 4.00 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|