C24H48O4Si2 — CID 11568750
tert-butyl-[(E,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-7-methylnon-6-en-8-yn-2-yl]oxy-dimethylsilane (PubChem CID 11568750) has the molecular formula C24H48O4Si2 and a molecular weight of 456.82 g/mol. Its IUPAC name is tert-butyl-[(E,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-7-methylnon-6-en-8-yn-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-7-methylnon-6-en-8-yn-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11568750 |
| Molecular Formula | C24H48O4Si2 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | tert-butyl-[(E,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-7-methylnon-6-en-8-yn-2-yl]oxy-dimethylsilane |
| SMILES | C#C/C(C)=C/[C@H](OCOC)[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O4Si2/c1-15-19(2)16-21(26-18-25-10)22(28-30(13,14)24(7,8)9)17-20(3)27-29(11,12)23(4,5)6/h1,16,20-22H,17-18H2,2-14H3/b19-16+/t20-,21-,22-/m0/s1 |
| InChIKey | TZKPKIRKDGLGSF-IKLGXSEVSA-N |
| XLogP | 6.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|