C21H40O4Si2 — CID 102384065
[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] ethyl carbonate (PubChem CID 102384065) has the molecular formula C21H40O4Si2 and a molecular weight of 412.72 g/mol. Its IUPAC name is [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] ethyl carbonate.
| Compound Name | [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] ethyl carbonate |
|---|---|
| PubChem CID | 102384065 |
| Molecular Formula | C21H40O4Si2 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | [(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-trimethylsilyloct-2-en-7-ynyl] ethyl carbonate |
| SMILES | CCOC(=O)OC/C=C(\C)[C@H](CCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si2/c1-11-23-20(22)24-16-15-18(2)19(14-12-13-17-26(6,7)8)25-27(9,10)21(3,4)5/h15,19H,11-12,14,16H2,1-10H3/b18-15+/t19-/m0/s1 |
| InChIKey | LSQIBMPNGVOQEA-DGDHUYAWSA-N |
| XLogP | 6.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|