C24H49IO4Si2 — CID 11621230
tert-butyl-[(2S,4S,5S,6E,8E)-4-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5-(methoxymethoxy)-7-methylnona-6,8-dien-2-yl]oxy-dimethylsilane (PubChem CID 11621230) has the molecular formula C24H49IO4Si2 and a molecular weight of 584.73 g/mol. Its IUPAC name is tert-butyl-[(2S,4S,5S,6E,8E)-4-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5-(methoxymethoxy)-7-methylnona-6,8-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,4S,5S,6E,8E)-4-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5-(methoxymethoxy)-7-methylnona-6,8-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11621230 |
| Molecular Formula | C24H49IO4Si2 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | tert-butyl-[(2S,4S,5S,6E,8E)-4-[tert-butyl(dimethyl)silyl]oxy-9-iodo-5-(methoxymethoxy)-7-methylnona-6,8-dien-2-yl]oxy-dimethylsilane |
| SMILES | COCO[C@@H](/C=C(C)/C=C/I)[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H49IO4Si2/c1-19(14-15-25)16-21(27-18-26-9)22(29-31(12,13)24(6,7)8)17-20(2)28-30(10,11)23(3,4)5/h14-16,20-22H,17-18H2,1-13H3/b15-14+,19-16+/t20-,21-,22-/m0/s1 |
| InChIKey | NDFMNPDTWATSGE-GHDFJXIESA-N |
| XLogP | 8.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|