C24H43IO3Si — CID 11763205
tert-butyl-[(2R,6E,8E)-9-[(4R,6S)-6-[(Z)-3-iodoprop-2-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]nona-6,8-dien-2-yl]oxy-dimethylsilane (PubChem CID 11763205) has the molecular formula C24H43IO3Si and a molecular weight of 534.60 g/mol. Its IUPAC name is tert-butyl-[(2R,6E,8E)-9-[(4R,6S)-6-[(Z)-3-iodoprop-2-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]nona-6,8-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,6E,8E)-9-[(4R,6S)-6-[(Z)-3-iodoprop-2-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]nona-6,8-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11763205 |
| Molecular Formula | C24H43IO3Si |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | tert-butyl-[(2R,6E,8E)-9-[(4R,6S)-6-[(Z)-3-iodoprop-2-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]nona-6,8-dien-2-yl]oxy-dimethylsilane |
| SMILES | C[C@H](CCC/C=C/C=C/[C@H]1C[C@H](C/C=C\I)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43IO3Si/c1-20(28-29(7,8)23(2,3)4)15-12-10-9-11-13-16-21-19-22(17-14-18-25)27-24(5,6)26-21/h9,11,13-14,16,18,20-22H,10,12,15,17,19H2,1-8H3/b11-9+,16-13+,18-14-/t20-,21+,22+/m1/s1 |
| InChIKey | PUCNFXSEQGBCAL-SRDXSQLLSA-N |
| XLogP | 7.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|