C36H68O4Si2 — CID 11444947
tert-butyl-[(2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(1E,3E,8R)-8-tri(propan-2-yl)silyloxynona-1,3-dienyl]-1,3-dioxan-4-yl]hexa-2,4-dienoxy]-dimethylsilane (PubChem CID 11444947) has the molecular formula C36H68O4Si2 and a molecular weight of 621.11 g/mol. Its IUPAC name is tert-butyl-[(2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(1E,3E,8R)-8-tri(propan-2-yl)silyloxynona-1,3-dienyl]-1,3-dioxan-4-yl]hexa-2,4-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(1E,3E,8R)-8-tri(propan-2-yl)silyloxynona-1,3-dienyl]-1,3-dioxan-4-yl]hexa-2,4-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11444947 |
| Molecular Formula | C36H68O4Si2 |
| Molecular Weight | 621.11 g/mol |
| Exact Mass | 620.47 |
| IUPAC Name | tert-butyl-[(2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(1E,3E,8R)-8-tri(propan-2-yl)silyloxynona-1,3-dienyl]-1,3-dioxan-4-yl]hexa-2,4-dienoxy]-dimethylsilane |
| SMILES | CC(C)[Si](O[C@H](C)CCC/C=C/C=C/[C@H]1C[C@H](C/C=C\C=C\CO[Si](C)(C)C(C)(C)C)OC(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H68O4Si2/c1-29(2)42(30(3)4,31(5)6)40-32(7)24-20-16-15-17-21-25-33-28-34(39-36(11,12)38-33)26-22-18-19-23-27-37-41(13,14)35(8,9)10/h15,17-19,21-23,25,29-34H,16,20,24,26-28H2,1-14H3/b17-15+,22-18-,23-19+,25-21+/t32-,33+,34+/m1/s1 |
| InChIKey | KJIPQHGPTQJDNT-UKTJZJNCSA-N |
| XLogP | 11.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.11 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|