C30H52O4Si — CID 11341101
(2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(1E,3E,8R)-8-tri(propan-2-yl)silyloxynona-1,3-dienyl]-1,3-dioxan-4-yl]hexa-2,4-dienal (PubChem CID 11341101) has the molecular formula C30H52O4Si and a molecular weight of 504.83 g/mol. Its IUPAC name is (2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(1E,3E,8R)-8-tri(propan-2-yl)silyloxynona-1,3-dienyl]-1,3-dioxan-4-yl]hexa-2,4-dienal.
| Compound Name | (2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(1E,3E,8R)-8-tri(propan-2-yl)silyloxynona-1,3-dienyl]-1,3-dioxan-4-yl]hexa-2,4-dienal |
|---|---|
| PubChem CID | 11341101 |
| Molecular Formula | C30H52O4Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | (2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(1E,3E,8R)-8-tri(propan-2-yl)silyloxynona-1,3-dienyl]-1,3-dioxan-4-yl]hexa-2,4-dienal |
| SMILES | CC(C)[Si](O[C@H](C)CCC/C=C/C=C/[C@H]1C[C@H](C/C=C\C=C\C=O)OC(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H52O4Si/c1-24(2)35(25(3)4,26(5)6)34-27(7)19-15-11-10-12-16-20-28-23-29(33-30(8,9)32-28)21-17-13-14-18-22-31/h10,12-14,16-18,20,22,24-29H,11,15,19,21,23H2,1-9H3/b12-10+,17-13-,18-14+,20-16+/t27-,28+,29+/m1/s1 |
| InChIKey | WXYHSKCIBRXCOA-BMYFCQQJSA-N |
| XLogP | 8.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|