C21H36O5Si — CID 25058809
(2R)-2-[(Z)-2-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethenyl]-2,3-dihydropyran-6-one (PubChem CID 25058809) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is (2R)-2-[(Z)-2-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethenyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(Z)-2-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethenyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 25058809 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (2R)-2-[(Z)-2-[(4S,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethenyl]-2,3-dihydropyran-6-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C[C@@H](/C=C\[C@H]2CC=CC(=O)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C21H36O5Si/c1-15(26-27(7,8)20(2,3)4)18-14-17(24-21(5,6)25-18)13-12-16-10-9-11-19(22)23-16/h9,11-13,15-18H,10,14H2,1-8H3/b13-12-/t15-,16+,17+,18+/m0/s1 |
| InChIKey | JUDFYRNJVFHVMX-NBILACBVSA-N |
| XLogP | 4.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|