C20H36O3Si — CID 101145364
tert-butyl-dimethyl-[[(2S,4R,7R)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-dien-7-yl]oxy]silane (PubChem CID 101145364) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,4R,7R)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-dien-7-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,4R,7R)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-dien-7-yl]oxy]silane |
|---|---|
| PubChem CID | 101145364 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,4R,7R)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-dien-7-yl]oxy]silane |
| SMILES | CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)C2(CC(C)=C1)O[C@H](C)C[C@H](C)O2 |
| InChI | InChI=1S/C20H36O3Si/c1-14-10-15(2)13-20(21-16(3)12-17(4)22-20)18(11-14)23-24(8,9)19(5,6)7/h10-11,16-18H,12-13H2,1-9H3/t16-,17+,18-,20?/m1/s1 |
| InChIKey | QNALIHMCOQMLOZ-RYRLBTNJSA-N |
| XLogP | 5.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|