C21H39IO6Si — CID 134982499
tert-butyl-[(2R)-2-[(4S,5R)-5-[(1E,3E)-4-iodobuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-methoxyethoxymethoxy)ethoxy]-dimethylsilane (PubChem CID 134982499) has the molecular formula C21H39IO6Si and a molecular weight of 542.53 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[(4S,5R)-5-[(1E,3E)-4-iodobuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-methoxyethoxymethoxy)ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-[(4S,5R)-5-[(1E,3E)-4-iodobuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-methoxyethoxymethoxy)ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134982499 |
| Molecular Formula | C21H39IO6Si |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | tert-butyl-[(2R)-2-[(4S,5R)-5-[(1E,3E)-4-iodobuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-methoxyethoxymethoxy)ethoxy]-dimethylsilane |
| SMILES | COCCOCO[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1/C=C/C=C/I |
| InChI | InChI=1S/C21H39IO6Si/c1-20(2,3)29(7,8)26-15-18(25-16-24-14-13-23-6)19-17(11-9-10-12-22)27-21(4,5)28-19/h9-12,17-19H,13-16H2,1-8H3/b11-9+,12-10+/t17-,18-,19+/m1/s1 |
| InChIKey | QWWFKJGXJVDIOX-HNTNWIASSA-N |
| XLogP | 5.04 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|