C20H40O7Si — CID 134887319
(E)-3-[(4R,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol (PubChem CID 134887319) has the molecular formula C20H40O7Si and a molecular weight of 420.62 g/mol. Its IUPAC name is (E)-3-[(4R,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(4R,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 134887319 |
| Molecular Formula | C20H40O7Si |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (E)-3-[(4R,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
| SMILES | COCCOCO[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1/C=C/CO |
| InChI | InChI=1S/C20H40O7Si/c1-19(2,3)28(7,8)25-14-17(24-15-23-13-12-22-6)18-16(10-9-11-21)26-20(4,5)27-18/h9-10,16-18,21H,11-15H2,1-8H3/b10-9+/t16-,17-,18+/m1/s1 |
| InChIKey | SUBGKZWXTGNXQW-FYGUHAFLSA-N |
| XLogP | 3.08 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|