C31H64O5Si3 — CID 10054323
[(4S,5S)-5-[(1E,3S,4S,5E)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hepta-1,5-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10054323) has the molecular formula C31H64O5Si3 and a molecular weight of 601.11 g/mol. Its IUPAC name is [(4S,5S)-5-[(1E,3S,4S,5E)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hepta-1,5-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S,5S)-5-[(1E,3S,4S,5E)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hepta-1,5-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10054323 |
| Molecular Formula | C31H64O5Si3 |
| Molecular Weight | 601.11 g/mol |
| Exact Mass | 600.41 |
| IUPAC Name | [(4S,5S)-5-[(1E,3S,4S,5E)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hepta-1,5-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O5Si3/c1-19-20-25(35-38(15,16)29(5,6)7)26(36-39(17,18)30(8,9)10)22-21-24-27(34-31(11,12)33-24)23-32-37(13,14)28(2,3)4/h19-22,24-27H,23H2,1-18H3/b20-19+,22-21+/t24-,25-,26-,27-/m0/s1 |
| InChIKey | LOHMGXKDJGNWDG-HKELHPCSSA-N |
| XLogP | 9.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.11 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|