C20H34O2Si2 — CID 15605685
tert-butyl-[(Z)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-trimethylsilylhex-3-en-1,5-diynyl]-dimethylsilane (PubChem CID 15605685) has the molecular formula C20H34O2Si2 and a molecular weight of 362.66 g/mol. Its IUPAC name is tert-butyl-[(Z)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-trimethylsilylhex-3-en-1,5-diynyl]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-trimethylsilylhex-3-en-1,5-diynyl]-dimethylsilane |
|---|---|
| PubChem CID | 15605685 |
| Molecular Formula | C20H34O2Si2 |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | tert-butyl-[(Z)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-trimethylsilylhex-3-en-1,5-diynyl]-dimethylsilane |
| SMILES | CC1(C)OC[C@@H](/C(C#C[Si](C)(C)C)=C\C#C[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H34O2Si2/c1-19(2,3)24(9,10)14-11-12-17(13-15-23(6,7)8)18-16-21-20(4,5)22-18/h12,18H,16H2,1-10H3/b17-12-/t18-/m0/s1 |
| InChIKey | NTBCZHNPZRTOEM-FSEPTYSPSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|