C9H17N3O2 — CID 167211718
(1E,3Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)buta-1,3-diene-1,2,4-triamine (PubChem CID 167211718) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is (1E,3Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)buta-1,3-diene-1,2,4-triamine.
| Compound Name | (1E,3Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)buta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 167211718 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (1E,3Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)buta-1,3-diene-1,2,4-triamine |
| SMILES | CC1(C)OCC(/C(N)=C/C(N)=C\N)O1 |
| InChI | InChI=1S/C9H17N3O2/c1-9(2)13-5-8(14-9)7(12)3-6(11)4-10/h3-4,8H,5,10-12H2,1-2H3/b6-4+,7-3- |
| InChIKey | HJEMALHMERLOSU-KUSYPTLRSA-N |
| XLogP | -0.26 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|