C12H21NO4S — CID 129026287
S-(1-acetamido-2-methylpropan-2-yl) 2,2-dimethyl-1,3-dioxolane-4-carbothioate (PubChem CID 129026287) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is S-(1-acetamido-2-methylpropan-2-yl) 2,2-dimethyl-1,3-dioxolane-4-carbothioate.
| Compound Name | S-(1-acetamido-2-methylpropan-2-yl) 2,2-dimethyl-1,3-dioxolane-4-carbothioate |
|---|---|
| PubChem CID | 129026287 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | S-(1-acetamido-2-methylpropan-2-yl) 2,2-dimethyl-1,3-dioxolane-4-carbothioate |
| SMILES | CC(=O)NCC(C)(C)SC(=O)C1COC(C)(C)O1 |
| InChI | InChI=1S/C12H21NO4S/c1-8(14)13-7-11(2,3)18-10(15)9-6-16-12(4,5)17-9/h9H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | GSIROZUUQKRDST-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|