C21H39IO4Si — CID 11341196
(4R,6S)-4-(iodomethyl)-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]-1,3-dioxan-2-one (PubChem CID 11341196) has the molecular formula C21H39IO4Si and a molecular weight of 510.53 g/mol. Its IUPAC name is (4R,6S)-4-(iodomethyl)-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]-1,3-dioxan-2-one.
| Compound Name | (4R,6S)-4-(iodomethyl)-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 11341196 |
| Molecular Formula | C21H39IO4Si |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | (4R,6S)-4-(iodomethyl)-6-[(Z,4R)-4-[tri(propan-2-yl)silyloxymethyl]hex-2-en-2-yl]-1,3-dioxan-2-one |
| SMILES | CC[C@H](/C=C(/C)[C@@H]1C[C@H](CI)OC(=O)O1)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H39IO4Si/c1-9-18(13-24-27(14(2)3,15(4)5)16(6)7)10-17(8)20-11-19(12-22)25-21(23)26-20/h10,14-16,18-20H,9,11-13H2,1-8H3/b17-10-/t18-,19-,20+/m1/s1 |
| InChIKey | HXLSPTSXIIQROD-REJQWRQBSA-N |
| XLogP | 6.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|